C12H15F2NO — CID 104704070
3-[2-(2,6-difluorophenyl)ethyl]morpholine (PubChem CID 104704070) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-[2-(2,6-difluorophenyl)ethyl]morpholine.
| Compound Name | 3-[2-(2,6-difluorophenyl)ethyl]morpholine |
|---|---|
| PubChem CID | 104704070 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[2-(2,6-difluorophenyl)ethyl]morpholine |
| SMILES | Fc1cccc(F)c1CCC1COCCN1 |
| InChI | InChI=1S/C12H15F2NO/c13-11-2-1-3-12(14)10(11)5-4-9-8-16-7-6-15-9/h1-3,9,15H,4-8H2 |
| InChIKey | FUPSOTNETDIKPC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |