C13H24N2O2 — CID 104704321
1-(5-heptyl-1,2,4-oxadiazol-3-yl)butan-1-ol (PubChem CID 104704321) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(5-heptyl-1,2,4-oxadiazol-3-yl)butan-1-ol.
| Compound Name | 1-(5-heptyl-1,2,4-oxadiazol-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 104704321 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-(5-heptyl-1,2,4-oxadiazol-3-yl)butan-1-ol |
| SMILES | CCCCCCCc1nc(C(O)CCC)no1 |
| InChI | InChI=1S/C13H24N2O2/c1-3-5-6-7-8-10-12-14-13(15-17-12)11(16)9-4-2/h11,16H,3-10H2,1-2H3 |
| InChIKey | BMUFEHIWVMCLNB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|