C13H18BrNO4 — CID 104707490
2-(2-bromo-4-methoxyphenoxy)-N-(2-methoxyethyl)propanamide (PubChem CID 104707490) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenoxy)-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(2-bromo-4-methoxyphenoxy)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 104707490 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenoxy)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Oc1ccc(OC)cc1Br |
| InChI | InChI=1S/C13H18BrNO4/c1-9(13(16)15-6-7-17-2)19-12-5-4-10(18-3)8-11(12)14/h4-5,8-9H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | DJUADANUMLEUTP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|