About 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol
3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol (PubChem CID 10470825) has the molecular formula C21H15NO2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol |
| PubChem CID | 10470825 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol |
| SMILES | Oc1cccc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C21H15NO2/c23-18-13-7-12-17(14-18)21-22-19(15-8-3-1-4-9-15)20(24-21)16-10-5-2-6-11-16/h1-14,23H |
| InChIKey | DSSWXPQYMJDVNT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol?
The IUPAC name of 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol (CID 10470825) is 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol.
What is the SMILES notation for 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol?
The canonical SMILES for 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol is Oc1cccc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1.
What is the InChIKey of 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol?
The InChIKey is DSSWXPQYMJDVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO2/c23-18-13-7-12-17(14-18)21-22-19(15-8-3-1-4-9-15)20(24-21)16-10-5-2-6-11-16/h1-14,23H.
What are the key properties of 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol?
3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol has a molecular weight of 313.36 g/mol, XLogP of 5.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-diphenyl-1,3-oxazol-2-yl)phenol is sourced from PubChem (CID 10470825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).