C12H9F7N2 — CID 10470855
2-[2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butyl]-1H-pyrrole (PubChem CID 10470855) has the molecular formula C12H9F7N2 and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-[2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butyl]-1H-pyrrole.
| Compound Name | 2-[2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butyl]-1H-pyrrole |
|---|---|
| PubChem CID | 10470855 |
| Molecular Formula | C12H9F7N2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[2,2,3,3,4,4,4-heptafluoro-1-(1H-pyrrol-2-yl)butyl]-1H-pyrrole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C12H9F7N2/c13-10(14,11(15,16)12(17,18)19)9(7-3-1-5-20-7)8-4-2-6-21-8/h1-6,9,20-21H |
| InChIKey | WUSAKTXDNLIMLJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|