C12H16N4O3S — CID 104709269
N-[2-(2-aminoethoxy)phenyl]-2-methylpyrazole-3-sulfonamide (PubChem CID 104709269) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)phenyl]-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[2-(2-aminoethoxy)phenyl]-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709269 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[2-(2-aminoethoxy)phenyl]-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)Nc1ccccc1OCCN |
| InChI | InChI=1S/C12H16N4O3S/c1-16-12(6-8-14-16)20(17,18)15-10-4-2-3-5-11(10)19-9-7-13/h2-6,8,15H,7,9,13H2,1H3 |
| InChIKey | SLPVBMVZCJTCJJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |