C18H21NO4 — CID 10470962
5,7-dimethoxy-3-(4-methoxyphenyl)-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 10470962) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5,7-dimethoxy-3-(4-methoxyphenyl)-4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 5,7-dimethoxy-3-(4-methoxyphenyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 10470962 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5,7-dimethoxy-3-(4-methoxyphenyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | COc1ccc(C2COc3cc(OC)cc(OC)c3N2C)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-19-15(12-5-7-13(20-2)8-6-12)11-23-17-10-14(21-3)9-16(22-4)18(17)19/h5-10,15H,11H2,1-4H3 |
| InChIKey | VQIKZTRFLINCTN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|