C20H17N3O — CID 10470968
5-(2-phenoxyethyl)-2-phenylimidazo[4,5-c]pyridine (PubChem CID 10470968) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-(2-phenoxyethyl)-2-phenylimidazo[4,5-c]pyridine.
| Compound Name | 5-(2-phenoxyethyl)-2-phenylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 10470968 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 5-(2-phenoxyethyl)-2-phenylimidazo[4,5-c]pyridine |
| SMILES | c1ccc(OCCn2ccc3nc(-c4ccccc4)nc-3c2)cc1 |
| InChI | InChI=1S/C20H17N3O/c1-3-7-16(8-4-1)20-21-18-11-12-23(15-19(18)22-20)13-14-24-17-9-5-2-6-10-17/h1-12,15H,13-14H2 |
| InChIKey | VLFIVVLETURKLB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |