C8H13N3O4S — CID 104710358
methyl 3-[(2-methylpyrazol-3-yl)sulfonylamino]propanoate (PubChem CID 104710358) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is methyl 3-[(2-methylpyrazol-3-yl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(2-methylpyrazol-3-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 104710358 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | methyl 3-[(2-methylpyrazol-3-yl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C8H13N3O4S/c1-11-7(3-5-9-11)16(13,14)10-6-4-8(12)15-2/h3,5,10H,4,6H2,1-2H3 |
| InChIKey | OVYWHYVPZWHLQS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |