C11H16ClN3O2S — CID 104710554
3-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-8-azabicyclo[3.2.1]octane (PubChem CID 104710554) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is 3-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 104710554 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-8-azabicyclo[3.2.1]octane |
| SMILES | Cn1nccc1S(=O)(=O)N1C2CCC1CC(Cl)C2 |
| InChI | InChI=1S/C11H16ClN3O2S/c1-14-11(4-5-13-14)18(16,17)15-9-2-3-10(15)7-8(12)6-9/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | NKOWIEPOWQXNRB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|