C17H31LiO3Si — CID 10471155
lithium [(3aS,5S,7aS)-5-methyl-2,3,3a,5,7,7a-hexahydrofuro[3,2-b]pyran-7-id-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 10471155) has the molecular formula C17H31LiO3Si and a molecular weight of 318.46 g/mol. Its IUPAC name is lithium [(3aS,5S,7aS)-5-methyl-2,3,3a,5,7,7a-hexahydrofuro[3,2-b]pyran-7-id-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | lithium [(3aS,5S,7aS)-5-methyl-2,3,3a,5,7,7a-hexahydrofuro[3,2-b]pyran-7-id-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10471155 |
| Molecular Formula | C17H31LiO3Si |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | lithium [(3aS,5S,7aS)-5-methyl-2,3,3a,5,7,7a-hexahydrofuro[3,2-b]pyran-7-id-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1C[C@@H]2O[C@@H](C)C=[C-][C@@H]2O1)(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C17H31O3Si.Li/c1-11(2)21(12(3)4,13(5)6)20-17-10-16-15(19-17)9-8-14(7)18-16;/h8,11-17H,10H2,1-7H3;/q-1;+1/t14-,15-,16-,17?;/m0./s1 |
| InChIKey | KESUPYFSVAGFMI-LQVSEQCOSA-N |
| XLogP | 1.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|