About 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine
2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine (PubChem CID 10471211) has the molecular formula C21H25N3
and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine |
| PubChem CID | 10471211 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(CCCC(c2ccccc2)c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H25N3/c22-15-14-19-16-23-21(24-19)13-7-12-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,16,20H,7,12-15,22H2,(H,23,24) |
| InChIKey | WPUIFWUHNWGBNW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine?
The IUPAC name of 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine (CID 10471211) is 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine.
What is the SMILES notation for 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine?
The canonical SMILES for 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine is NCCc1cnc(CCCC(c2ccccc2)c2ccccc2)[nH]1.
What is the InChIKey of 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine?
The InChIKey is WPUIFWUHNWGBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3/c22-15-14-19-16-23-21(24-19)13-7-12-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,16,20H,7,12-15,22H2,(H,23,24).
What are the key properties of 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine?
2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine has a molecular weight of 319.45 g/mol, XLogP of 4.07, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,4-diphenylbutyl)-1H-imidazol-5-yl]ethanamine is sourced from PubChem (CID 10471211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).