About 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione
11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione (PubChem CID 10471228) has the molecular formula C19H12O5
and a molecular weight of 320.30 g/mol. Its IUPAC name is 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione.
Molecular Properties
| Compound Name | 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione |
| PubChem CID | 10471228 |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione |
| SMILES | COc1cccc2c1C(=O)c1c(ccc3c(=O)cc(C)oc13)C2=O |
| InChI | InChI=1S/C19H12O5/c1-9-8-13(20)10-6-7-12-16(19(10)24-9)18(22)15-11(17(12)21)4-3-5-14(15)23-2/h3-8H,1-2H3 |
| InChIKey | RRGAABHOHNSLRZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione?
The IUPAC name of 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione (CID 10471228) is 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione.
What is the SMILES notation for 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione?
The canonical SMILES for 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione is COc1cccc2c1C(=O)c1c(ccc3c(=O)cc(C)oc13)C2=O.
What is the InChIKey of 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione?
The InChIKey is RRGAABHOHNSLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12O5/c1-9-8-13(20)10-6-7-12-16(19(10)24-9)18(22)15-11(17(12)21)4-3-5-14(15)23-2/h3-8H,1-2H3.
What are the key properties of 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione?
11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione has a molecular weight of 320.30 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methoxy-2-methylnaphtho[2,3-h]chromene-4,7,12-trione is sourced from PubChem (CID 10471228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).