C22H28N2 — CID 10471267
(1R,8S,9R)-10,10-dimethyl-8-pentyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene (PubChem CID 10471267) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (1R,8S,9R)-10,10-dimethyl-8-pentyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1R,8S,9R)-10,10-dimethyl-8-pentyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10471267 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (1R,8S,9R)-10,10-dimethyl-8-pentyl-5-pyridin-2-yl-6-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CCCCC[C@@H]1c2nc(-c3ccccn3)ccc2[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C22H28N2/c1-4-5-6-9-15-17-14-18(22(17,2)3)16-11-12-20(24-21(15)16)19-10-7-8-13-23-19/h7-8,10-13,15,17-18H,4-6,9,14H2,1-3H3/t15-,17+,18-/m0/s1 |
| InChIKey | DAAZFJUOBBVOJS-JQHSSLGASA-N |
| XLogP | 5.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|