C13H13N3O5 — CID 104712992
2-[4-(5-cyano-2-nitrophenyl)morpholin-2-yl]acetic acid (PubChem CID 104712992) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[4-(5-cyano-2-nitrophenyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(5-cyano-2-nitrophenyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 104712992 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[4-(5-cyano-2-nitrophenyl)morpholin-2-yl]acetic acid |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(N2CCOC(CC(=O)O)C2)c1 |
| InChI | InChI=1S/C13H13N3O5/c14-7-9-1-2-11(16(19)20)12(5-9)15-3-4-21-10(8-15)6-13(17)18/h1-2,5,10H,3-4,6,8H2,(H,17,18) |
| InChIKey | MVCSQEQAHNVMOT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|