C16H14N6O2 — CID 10471361
4-(11,13-diamino-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-4-yl)benzoic acid (PubChem CID 10471361) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-(11,13-diamino-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-4-yl)benzoic acid.
| Compound Name | 4-(11,13-diamino-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-4-yl)benzoic acid |
|---|---|
| PubChem CID | 10471361 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(11,13-diamino-4,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaen-4-yl)benzoic acid |
| SMILES | Nc1nc(N)c2c3c(cnc2n1)CN(c1ccc(C(=O)O)cc1)C3 |
| InChI | InChI=1S/C16H14N6O2/c17-13-12-11-7-22(10-3-1-8(2-4-10)15(23)24)6-9(11)5-19-14(12)21-16(18)20-13/h1-5H,6-7H2,(H,23,24)(H4,17,18,19,20,21) |
| InChIKey | MNFDLCVDBYBJQE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |