C16H14N4O — CID 104714819
2-amino-3-(2-ethoxyphenyl)benzimidazole-5-carbonitrile (PubChem CID 104714819) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-amino-3-(2-ethoxyphenyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-amino-3-(2-ethoxyphenyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714819 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-amino-3-(2-ethoxyphenyl)benzimidazole-5-carbonitrile |
| SMILES | CCOc1ccccc1-n1c(N)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C16H14N4O/c1-2-21-15-6-4-3-5-13(15)20-14-9-11(10-17)7-8-12(14)19-16(20)18/h3-9H,2H2,1H3,(H2,18,19) |
| InChIKey | TUNZHUFEWJUIEI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |