C13H14N4O2S — CID 104714851
2-amino-3-(1,1-dioxothian-4-yl)benzimidazole-5-carbonitrile (PubChem CID 104714851) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-amino-3-(1,1-dioxothian-4-yl)benzimidazole-5-carbonitrile.
| Compound Name | 2-amino-3-(1,1-dioxothian-4-yl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714851 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-amino-3-(1,1-dioxothian-4-yl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(N)n(C3CCS(=O)(=O)CC3)c2c1 |
| InChI | InChI=1S/C13H14N4O2S/c14-8-9-1-2-11-12(7-9)17(13(15)16-11)10-3-5-20(18,19)6-4-10/h1-2,7,10H,3-6H2,(H2,15,16) |
| InChIKey | PUFMXCKVUBYULT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |