C15H14ClN5 — CID 104715567
2-(chloromethyl)-3-(1-imidazol-1-ylpropan-2-yl)benzimidazole-5-carbonitrile (PubChem CID 104715567) has the molecular formula C15H14ClN5 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(1-imidazol-1-ylpropan-2-yl)benzimidazole-5-carbonitrile.
| Compound Name | 2-(chloromethyl)-3-(1-imidazol-1-ylpropan-2-yl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104715567 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(chloromethyl)-3-(1-imidazol-1-ylpropan-2-yl)benzimidazole-5-carbonitrile |
| SMILES | CC(Cn1ccnc1)n1c(CCl)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C15H14ClN5/c1-11(9-20-5-4-18-10-20)21-14-6-12(8-17)2-3-13(14)19-15(21)7-16/h2-6,10-11H,7,9H2,1H3 |
| InChIKey | CZMNIBSAQFDHNF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|