C11H14N4O — CID 104716594
3-(2-amino-3-cyanoanilino)-N-methylpropanamide (PubChem CID 104716594) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(2-amino-3-cyanoanilino)-N-methylpropanamide.
| Compound Name | 3-(2-amino-3-cyanoanilino)-N-methylpropanamide |
|---|---|
| PubChem CID | 104716594 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-(2-amino-3-cyanoanilino)-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1cccc(C#N)c1N |
| InChI | InChI=1S/C11H14N4O/c1-14-10(16)5-6-15-9-4-2-3-8(7-12)11(9)13/h2-4,15H,5-6,13H2,1H3,(H,14,16) |
| InChIKey | YAXBMASSMZGFGW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|