C14H21N5 — CID 104716781
2-amino-3-[(1,4-dimethylpiperazin-2-yl)methylamino]benzonitrile (PubChem CID 104716781) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-amino-3-[(1,4-dimethylpiperazin-2-yl)methylamino]benzonitrile.
| Compound Name | 2-amino-3-[(1,4-dimethylpiperazin-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 104716781 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-amino-3-[(1,4-dimethylpiperazin-2-yl)methylamino]benzonitrile |
| SMILES | CN1CCN(C)C(CNc2cccc(C#N)c2N)C1 |
| InChI | InChI=1S/C14H21N5/c1-18-6-7-19(2)12(10-18)9-17-13-5-3-4-11(8-15)14(13)16/h3-5,12,17H,6-7,9-10,16H2,1-2H3 |
| InChIKey | OBHKCLBSJWMCKC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|