C17H25N3 — CID 104716929
2-amino-3-[cyclopentyl(3-methylbutyl)amino]benzonitrile (PubChem CID 104716929) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-amino-3-[cyclopentyl(3-methylbutyl)amino]benzonitrile.
| Compound Name | 2-amino-3-[cyclopentyl(3-methylbutyl)amino]benzonitrile |
|---|---|
| PubChem CID | 104716929 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-amino-3-[cyclopentyl(3-methylbutyl)amino]benzonitrile |
| SMILES | CC(C)CCN(c1cccc(C#N)c1N)C1CCCC1 |
| InChI | InChI=1S/C17H25N3/c1-13(2)10-11-20(15-7-3-4-8-15)16-9-5-6-14(12-18)17(16)19/h5-6,9,13,15H,3-4,7-8,10-11,19H2,1-2H3 |
| InChIKey | NMTFGLSAWMJTRN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|