C15H14N2O3 — CID 104717214
2-amino-3-(3,5-dimethoxyphenoxy)benzonitrile (PubChem CID 104717214) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-amino-3-(3,5-dimethoxyphenoxy)benzonitrile.
| Compound Name | 2-amino-3-(3,5-dimethoxyphenoxy)benzonitrile |
|---|---|
| PubChem CID | 104717214 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-amino-3-(3,5-dimethoxyphenoxy)benzonitrile |
| SMILES | COc1cc(OC)cc(Oc2cccc(C#N)c2N)c1 |
| InChI | InChI=1S/C15H14N2O3/c1-18-11-6-12(19-2)8-13(7-11)20-14-5-3-4-10(9-16)15(14)17/h3-8H,17H2,1-2H3 |
| InChIKey | QORNDHCLBPCOPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|