About 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile
2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile (PubChem CID 104717521) has the molecular formula C11H9N3S2
and a molecular weight of 247.35 g/mol. Its IUPAC name is 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile.
Molecular Properties
| Compound Name | 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile |
| PubChem CID | 104717521 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile |
| SMILES | Cc1csc(Sc2cccc(C#N)c2N)n1 |
| InChI | InChI=1S/C11H9N3S2/c1-7-6-15-11(14-7)16-9-4-2-3-8(5-12)10(9)13/h2-4,6H,13H2,1H3 |
| InChIKey | MWSBKJVREHJZGC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile?
The IUPAC name of 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile (CID 104717521) is 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile.
What is the SMILES notation for 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile?
The canonical SMILES for 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile is Cc1csc(Sc2cccc(C#N)c2N)n1.
What is the InChIKey of 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile?
The InChIKey is MWSBKJVREHJZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3S2/c1-7-6-15-11(14-7)16-9-4-2-3-8(5-12)10(9)13/h2-4,6H,13H2,1H3.
What are the key properties of 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile?
2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile has a molecular weight of 247.35 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile is sourced from PubChem (CID 104717521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).