About N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide
N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide (PubChem CID 10471770) has the molecular formula C17H15NO4S
and a molecular weight of 329.38 g/mol. Its IUPAC name is N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide |
| PubChem CID | 10471770 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide |
| SMILES | CCc1ccc2c(c1)S(=O)(=O)c1cc(NC(C)=O)ccc1C2=O |
| InChI | InChI=1S/C17H15NO4S/c1-3-11-4-6-13-15(8-11)23(21,22)16-9-12(18-10(2)19)5-7-14(16)17(13)20/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | LLFAQNPOQRERLJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide?
The IUPAC name of N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide (CID 10471770) is N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide.
What is the SMILES notation for N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide?
The canonical SMILES for N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide is CCc1ccc2c(c1)S(=O)(=O)c1cc(NC(C)=O)ccc1C2=O.
What is the InChIKey of N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide?
The InChIKey is LLFAQNPOQRERLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4S/c1-3-11-4-6-13-15(8-11)23(21,22)16-9-12(18-10(2)19)5-7-14(16)17(13)20/h4-9H,3H2,1-2H3,(H,18,19).
What are the key properties of N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide?
N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide has a molecular weight of 329.38 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-ethyl-9,10,10-trioxothioxanthen-3-yl)acetamide is sourced from PubChem (CID 10471770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).