C14H14N6O4 — CID 10471809
ethyl (E)-2-methyl-3-(7-methyl-3,13-dioxo-1,2,4,5,10,11-hexazatricyclo[7.4.0.02,6]trideca-5,7,9,11-tetraen-12-yl)prop-2-enoate (PubChem CID 10471809) has the molecular formula C14H14N6O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-(7-methyl-3,13-dioxo-1,2,4,5,10,11-hexazatricyclo[7.4.0.02,6]trideca-5,7,9,11-tetraen-12-yl)prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-(7-methyl-3,13-dioxo-1,2,4,5,10,11-hexazatricyclo[7.4.0.02,6]trideca-5,7,9,11-tetraen-12-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10471809 |
| Molecular Formula | C14H14N6O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl (E)-2-methyl-3-(7-methyl-3,13-dioxo-1,2,4,5,10,11-hexazatricyclo[7.4.0.02,6]trideca-5,7,9,11-tetraen-12-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1nnc2cc(C)c3n[nH]c(=O)n3n2c1=O |
| InChI | InChI=1S/C14H14N6O4/c1-4-24-13(22)8(3)5-9-12(21)19-10(16-15-9)6-7(2)11-17-18-14(23)20(11)19/h5-6H,4H2,1-3H3,(H,18,23)/b8-5+ |
| InChIKey | VDVZOGDDRFPTKY-VMPITWQZSA-N |
| XLogP | -0.30 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|