About 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine
1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine (PubChem CID 10471851) has the molecular formula C20H30N2O2
and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine.
Molecular Properties
| Compound Name | 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine |
| PubChem CID | 10471851 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine |
| SMILES | c1cc2c(c(N3CCN(CCC4CCCCC4)CC3)c1)OCCO2 |
| InChI | InChI=1S/C20H30N2O2/c1-2-5-17(6-3-1)9-10-21-11-13-22(14-12-21)18-7-4-8-19-20(18)24-16-15-23-19/h4,7-8,17H,1-3,5-6,9-16H2 |
| InChIKey | PIXPONBGJIYLST-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine?
The IUPAC name of 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine (CID 10471851) is 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine.
What is the SMILES notation for 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine?
The canonical SMILES for 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine is c1cc2c(c(N3CCN(CCC4CCCCC4)CC3)c1)OCCO2.
What is the InChIKey of 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine?
The InChIKey is PIXPONBGJIYLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O2/c1-2-5-17(6-3-1)9-10-21-11-13-22(14-12-21)18-7-4-8-19-20(18)24-16-15-23-19/h4,7-8,17H,1-3,5-6,9-16H2.
What are the key properties of 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine?
1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine has a molecular weight of 330.47 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine is sourced from PubChem (CID 10471851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).