C15H19N5 — CID 104718640
2-amino-1-[(1-ethylpyrrolidin-2-yl)methyl]benzimidazole-4-carbonitrile (PubChem CID 104718640) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-amino-1-[(1-ethylpyrrolidin-2-yl)methyl]benzimidazole-4-carbonitrile.
| Compound Name | 2-amino-1-[(1-ethylpyrrolidin-2-yl)methyl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104718640 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-amino-1-[(1-ethylpyrrolidin-2-yl)methyl]benzimidazole-4-carbonitrile |
| SMILES | CCN1CCCC1Cn1c(N)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C15H19N5/c1-2-19-8-4-6-12(19)10-20-13-7-3-5-11(9-16)14(13)18-15(20)17/h3,5,7,12H,2,4,6,8,10H2,1H3,(H2,17,18) |
| InChIKey | CXEFOPUXGLPEPK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |