About 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione
6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione (PubChem CID 10471922) has the molecular formula C18H18ClNOS
and a molecular weight of 331.87 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione.
Molecular Properties
| Compound Name | 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione |
| PubChem CID | 10471922 |
| Molecular Formula | C18H18ClNOS |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione |
| SMILES | CCC1(CC)OC(=S)Nc2ccc(-c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C18H18ClNOS/c1-3-18(4-2)15-11-13(12-6-5-7-14(19)10-12)8-9-16(15)20-17(22)21-18/h5-11H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | HWFFFZIEYMMDDC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione?
The IUPAC name of 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione (CID 10471922) is 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione.
What is the SMILES notation for 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione?
The canonical SMILES for 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione is CCC1(CC)OC(=S)Nc2ccc(-c3cccc(Cl)c3)cc21.
What is the InChIKey of 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione?
The InChIKey is HWFFFZIEYMMDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNOS/c1-3-18(4-2)15-11-13(12-6-5-7-14(19)10-12)8-9-16(15)20-17(22)21-18/h5-11H,3-4H2,1-2H3,(H,20,22).
What are the key properties of 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione?
6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione has a molecular weight of 331.87 g/mol, XLogP of 5.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chlorophenyl)-4,4-diethyl-1H-3,1-benzoxazine-2-thione is sourced from PubChem (CID 10471922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).