C15H18ClN3O — CID 104719749
2-(1-chloroethyl)-1-(1-methoxybutan-2-yl)benzimidazole-4-carbonitrile (PubChem CID 104719749) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(1-methoxybutan-2-yl)benzimidazole-4-carbonitrile.
| Compound Name | 2-(1-chloroethyl)-1-(1-methoxybutan-2-yl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719749 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(1-chloroethyl)-1-(1-methoxybutan-2-yl)benzimidazole-4-carbonitrile |
| SMILES | CCC(COC)n1c(C(C)Cl)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C15H18ClN3O/c1-4-12(9-20-3)19-13-7-5-6-11(8-17)14(13)18-15(19)10(2)16/h5-7,10,12H,4,9H2,1-3H3 |
| InChIKey | JARBLIMMGMNOOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|