C15H16ClN3S — CID 104719840
2-(2-chloroethyl)-1-(thiolan-2-ylmethyl)benzimidazole-4-carbonitrile (PubChem CID 104719840) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(thiolan-2-ylmethyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-(2-chloroethyl)-1-(thiolan-2-ylmethyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719840 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(2-chloroethyl)-1-(thiolan-2-ylmethyl)benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(CCCl)n2CC1CCCS1 |
| InChI | InChI=1S/C15H16ClN3S/c16-7-6-14-18-15-11(9-17)3-1-5-13(15)19(14)10-12-4-2-8-20-12/h1,3,5,12H,2,4,6-8,10H2 |
| InChIKey | NNGMEWKECXAYKT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|