About N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide
N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide (PubChem CID 10472023) has the molecular formula C21H23N3O
and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide.
Molecular Properties
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide |
| PubChem CID | 10472023 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide |
| SMILES | O=C(CCC(c1ccccc1)c1ccccc1)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C21H23N3O/c25-21(23-14-13-19-15-22-16-24-19)12-11-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,15-16,20H,11-14H2,(H,22,24)(H,23,25) |
| InChIKey | MRTDXSGEVJTPED-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide?
The IUPAC name of N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide (CID 10472023) is N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide.
What is the SMILES notation for N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide?
The canonical SMILES for N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide is O=C(CCC(c1ccccc1)c1ccccc1)NCCc1cnc[nH]1.
What is the InChIKey of N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide?
The InChIKey is MRTDXSGEVJTPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O/c25-21(23-14-13-19-15-22-16-24-19)12-11-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,15-16,20H,11-14H2,(H,22,24)(H,23,25).
What are the key properties of N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide?
N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide has a molecular weight of 333.44 g/mol, XLogP of 3.68, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1H-imidazol-5-yl)ethyl]-4,4-diphenylbutanamide is sourced from PubChem (CID 10472023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).