About 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile
3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile (PubChem CID 104720352) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile |
| PubChem CID | 104720352 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile |
| SMILES | CC(C)CC(CC(C)C)NCC(C)(C)C#N |
| InChI | InChI=1S/C14H28N2/c1-11(2)7-13(8-12(3)4)16-10-14(5,6)9-15/h11-13,16H,7-8,10H2,1-6H3 |
| InChIKey | PSLFZDAKXJGZCZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile?
The IUPAC name of 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile (CID 104720352) is 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile is CC(C)CC(CC(C)C)NCC(C)(C)C#N.
What is the InChIKey of 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile?
The InChIKey is PSLFZDAKXJGZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-11(2)7-13(8-12(3)4)16-10-14(5,6)9-15/h11-13,16H,7-8,10H2,1-6H3.
What are the key properties of 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile?
3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile has a molecular weight of 224.39 g/mol, XLogP of 3.59, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylheptan-4-ylamino)-2,2-dimethylpropanenitrile is sourced from PubChem (CID 104720352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).