C11H11N3O — CID 104720448
2-(ethoxymethyl)-1H-benzimidazole-4-carbonitrile (PubChem CID 104720448) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1H-benzimidazole-4-carbonitrile.
| Compound Name | 2-(ethoxymethyl)-1H-benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104720448 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-(ethoxymethyl)-1H-benzimidazole-4-carbonitrile |
| SMILES | CCOCc1nc2c(C#N)cccc2[nH]1 |
| InChI | InChI=1S/C11H11N3O/c1-2-15-7-10-13-9-5-3-4-8(6-12)11(9)14-10/h3-5H,2,7H2,1H3,(H,13,14) |
| InChIKey | FMMGEQDNOMZSQZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |