About ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate
ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate (PubChem CID 10472179) has the molecular formula C17H18F2N2O3
and a molecular weight of 336.34 g/mol. Its IUPAC name is ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate |
| PubChem CID | 10472179 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C17H18F2N2O3/c1-3-24-17(22)21-15-7-6-13(9-16(15)23-2)20-10-11-4-5-12(18)8-14(11)19/h4-9,20H,3,10H2,1-2H3,(H,21,22) |
| InChIKey | XDKSFHCRKBLVPN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate?
The IUPAC name of ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate (CID 10472179) is ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate.
What is the SMILES notation for ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate?
The canonical SMILES for ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate is CCOC(=O)Nc1ccc(NCc2ccc(F)cc2F)cc1OC.
What is the InChIKey of ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate?
The InChIKey is XDKSFHCRKBLVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2O3/c1-3-24-17(22)21-15-7-6-13(9-16(15)23-2)20-10-11-4-5-12(18)8-14(11)19/h4-9,20H,3,10H2,1-2H3,(H,21,22).
What are the key properties of ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate?
ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate has a molecular weight of 336.34 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[4-[(2,4-difluorophenyl)methylamino]-2-methoxyphenyl]carbamate is sourced from PubChem (CID 10472179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).