C16H25ClN2 — CID 104721790
1-(aminomethyl)-N-(3-chloro-4-methylphenyl)cyclooctan-1-amine (PubChem CID 104721790) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(3-chloro-4-methylphenyl)cyclooctan-1-amine.
| Compound Name | 1-(aminomethyl)-N-(3-chloro-4-methylphenyl)cyclooctan-1-amine |
|---|---|
| PubChem CID | 104721790 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-(aminomethyl)-N-(3-chloro-4-methylphenyl)cyclooctan-1-amine |
| SMILES | Cc1ccc(NC2(CN)CCCCCCC2)cc1Cl |
| InChI | InChI=1S/C16H25ClN2/c1-13-7-8-14(11-15(13)17)19-16(12-18)9-5-3-2-4-6-10-16/h7-8,11,19H,2-6,9-10,12,18H2,1H3 |
| InChIKey | QCSGITPCCBERSA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |