C13H13BrClN3O — CID 104722153
4-amino-N-(2-bromo-5-chloro-4-methylphenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 104722153) has the molecular formula C13H13BrClN3O and a molecular weight of 342.62 g/mol. Its IUPAC name is 4-amino-N-(2-bromo-5-chloro-4-methylphenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2-bromo-5-chloro-4-methylphenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104722153 |
| Molecular Formula | C13H13BrClN3O |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 4-amino-N-(2-bromo-5-chloro-4-methylphenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(N)cn2C)cc1Cl |
| InChI | InChI=1S/C13H13BrClN3O/c1-7-3-9(14)11(5-10(7)15)17-13(19)12-4-8(16)6-18(12)2/h3-6H,16H2,1-2H3,(H,17,19) |
| InChIKey | DTFBGDYNNFVPNZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |