C19H31NO4 — CID 10472264
(1S,6R,8R)-5-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-11,11-dimethyl-3-oxa-5-azatricyclo[6.2.1.01,6]undecan-4-one (PubChem CID 10472264) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is (1S,6R,8R)-5-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-11,11-dimethyl-3-oxa-5-azatricyclo[6.2.1.01,6]undecan-4-one.
| Compound Name | (1S,6R,8R)-5-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-11,11-dimethyl-3-oxa-5-azatricyclo[6.2.1.01,6]undecan-4-one |
|---|---|
| PubChem CID | 10472264 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (1S,6R,8R)-5-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-11,11-dimethyl-3-oxa-5-azatricyclo[6.2.1.01,6]undecan-4-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@]23CC[C@H](C[C@@H]12)C3(C)C)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C19H31NO4/c1-11(14(21)17(2,3)4)15(22)20-13-9-12-7-8-19(13,18(12,5)6)10-24-16(20)23/h11-14,21H,7-10H2,1-6H3/t11-,12+,13+,14-,19+/m0/s1 |
| InChIKey | WDFXMLKKDDFTFM-WNOJGISRSA-N |
| XLogP | 3.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |