C16H14BrClN2O — CID 104722812
2-[4-[(2-bromo-5-chloro-4-methylanilino)methyl]phenoxy]acetonitrile (PubChem CID 104722812) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is 2-[4-[(2-bromo-5-chloro-4-methylanilino)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(2-bromo-5-chloro-4-methylanilino)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 104722812 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2-[4-[(2-bromo-5-chloro-4-methylanilino)methyl]phenoxy]acetonitrile |
| SMILES | Cc1cc(Br)c(NCc2ccc(OCC#N)cc2)cc1Cl |
| InChI | InChI=1S/C16H14BrClN2O/c1-11-8-14(17)16(9-15(11)18)20-10-12-2-4-13(5-3-12)21-7-6-19/h2-5,8-9,20H,7,10H2,1H3 |
| InChIKey | IFIAKIARBBMQPZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |