C14H16BrN3O2 — CID 10472283
6-bromo-8-propyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione (PubChem CID 10472283) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 6-bromo-8-propyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione.
| Compound Name | 6-bromo-8-propyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10472283 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 6-bromo-8-propyl-4,7,9,10-tetrahydro-1H-pyrido[4,3-f]quinoxaline-2,3-dione |
| SMILES | CCCN1CCc2c(c(Br)cc3[nH]c(=O)c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-2-4-18-5-3-8-9(7-18)10(15)6-11-12(8)17-14(20)13(19)16-11/h6H,2-5,7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | AYKHPSMVRLCRKQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|