C15H14BrClN2O — CID 104723637
4-(aminomethyl)-N-(2-bromo-5-chloro-4-methylphenyl)benzamide (PubChem CID 104723637) has the molecular formula C15H14BrClN2O and a molecular weight of 353.65 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-bromo-5-chloro-4-methylphenyl)benzamide.
| Compound Name | 4-(aminomethyl)-N-(2-bromo-5-chloro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 104723637 |
| Molecular Formula | C15H14BrClN2O |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 4-(aminomethyl)-N-(2-bromo-5-chloro-4-methylphenyl)benzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2ccc(CN)cc2)cc1Cl |
| InChI | InChI=1S/C15H14BrClN2O/c1-9-6-12(16)14(7-13(9)17)19-15(20)11-4-2-10(8-18)3-5-11/h2-7H,8,18H2,1H3,(H,19,20) |
| InChIKey | FDTGNRMKGBOLFU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |