C14H13Cl2FN2O — CID 104725821
1-N-(2,5-dichloro-4-methylphenyl)-4-fluoro-5-methoxybenzene-1,2-diamine (PubChem CID 104725821) has the molecular formula C14H13Cl2FN2O and a molecular weight of 315.18 g/mol. Its IUPAC name is 1-N-(2,5-dichloro-4-methylphenyl)-4-fluoro-5-methoxybenzene-1,2-diamine.
| Compound Name | 1-N-(2,5-dichloro-4-methylphenyl)-4-fluoro-5-methoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 104725821 |
| Molecular Formula | C14H13Cl2FN2O |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-N-(2,5-dichloro-4-methylphenyl)-4-fluoro-5-methoxybenzene-1,2-diamine |
| SMILES | COc1cc(Nc2cc(Cl)c(C)cc2Cl)c(N)cc1F |
| InChI | InChI=1S/C14H13Cl2FN2O/c1-7-3-9(16)12(4-8(7)15)19-13-6-14(20-2)10(17)5-11(13)18/h3-6,19H,18H2,1-2H3 |
| InChIKey | NKLUZQFIKCKXHM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|