C17H16Cl3N — CID 104726394
2,5-dichloro-N-[3-(4-chlorophenyl)cyclobutyl]-4-methylaniline (PubChem CID 104726394) has the molecular formula C17H16Cl3N and a molecular weight of 340.68 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(4-chlorophenyl)cyclobutyl]-4-methylaniline.
| Compound Name | 2,5-dichloro-N-[3-(4-chlorophenyl)cyclobutyl]-4-methylaniline |
|---|---|
| PubChem CID | 104726394 |
| Molecular Formula | C17H16Cl3N |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2,5-dichloro-N-[3-(4-chlorophenyl)cyclobutyl]-4-methylaniline |
| SMILES | Cc1cc(Cl)c(NC2CC(c3ccc(Cl)cc3)C2)cc1Cl |
| InChI | InChI=1S/C17H16Cl3N/c1-10-6-16(20)17(9-15(10)19)21-14-7-12(8-14)11-2-4-13(18)5-3-11/h2-6,9,12,14,21H,7-8H2,1H3 |
| InChIKey | GUSPIJSVEUHTIW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |