C18H11F3N2O2 — CID 10472649
2-(2,4-difluorophenyl)-6-(2-fluoroanilino)pyridine-3-carboxylic acid (PubChem CID 10472649) has the molecular formula C18H11F3N2O2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-(2-fluoroanilino)pyridine-3-carboxylic acid.
| Compound Name | 2-(2,4-difluorophenyl)-6-(2-fluoroanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10472649 |
| Molecular Formula | C18H11F3N2O2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-(2-fluoroanilino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Nc2ccccc2F)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C18H11F3N2O2/c19-10-5-6-11(14(21)9-10)17-12(18(24)25)7-8-16(23-17)22-15-4-2-1-3-13(15)20/h1-9H,(H,22,23)(H,24,25) |
| InChIKey | FOJCZXCRXGGFAB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |