About 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine
3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 104727548) has the molecular formula C14H12Cl2N4
and a molecular weight of 307.18 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 104727548 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cnc2c(c1)nc(N)n2-c1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4/c1-7-3-11-13(18-6-7)20(14(17)19-11)12-5-9(15)8(2)4-10(12)16/h3-6H,1-2H3,(H2,17,19) |
| InChIKey | XNRLPCDZPVRGMP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine (CID 104727548) is 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine is Cc1cnc2c(c1)nc(N)n2-c1cc(Cl)c(C)cc1Cl.
What is the InChIKey of 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine?
The InChIKey is XNRLPCDZPVRGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N4/c1-7-3-11-13(18-6-7)20(14(17)19-11)12-5-9(15)8(2)4-10(12)16/h3-6H,1-2H3,(H2,17,19).
What are the key properties of 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine?
3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine has a molecular weight of 307.18 g/mol, XLogP of 3.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dichloro-4-methylphenyl)-6-methylimidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 104727548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).