C15H12Cl3N3 — CID 104727613
2-(2-chloroethyl)-3-(2,5-dichloro-4-methylphenyl)imidazo[4,5-b]pyridine (PubChem CID 104727613) has the molecular formula C15H12Cl3N3 and a molecular weight of 340.64 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-(2,5-dichloro-4-methylphenyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-(2,5-dichloro-4-methylphenyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 104727613 |
| Molecular Formula | C15H12Cl3N3 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-(2-chloroethyl)-3-(2,5-dichloro-4-methylphenyl)imidazo[4,5-b]pyridine |
| SMILES | Cc1cc(Cl)c(-n2c(CCCl)nc3cccnc32)cc1Cl |
| InChI | InChI=1S/C15H12Cl3N3/c1-9-7-11(18)13(8-10(9)17)21-14(4-5-16)20-12-3-2-6-19-15(12)21/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | AFNQFTGRLXRXJI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|