C15H10Cl2N2O2 — CID 104727768
3-(2,5-dichloro-4-methylphenyl)benzimidazole-5-carboxylic acid (PubChem CID 104727768) has the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-methylphenyl)benzimidazole-5-carboxylic acid.
| Compound Name | 3-(2,5-dichloro-4-methylphenyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 104727768 |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-(2,5-dichloro-4-methylphenyl)benzimidazole-5-carboxylic acid |
| SMILES | Cc1cc(Cl)c(-n2cnc3ccc(C(=O)O)cc32)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N2O2/c1-8-4-11(17)13(6-10(8)16)19-7-18-12-3-2-9(15(20)21)5-14(12)19/h2-7H,1H3,(H,20,21) |
| InChIKey | UVJZVKJBIBFUOA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |