About [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine
[3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine (PubChem CID 104729116) has the molecular formula C13H9Cl4N
and a molecular weight of 321.03 g/mol. Its IUPAC name is [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine |
| PubChem CID | 104729116 |
| Molecular Formula | C13H9Cl4N |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl4N/c14-8-4-11(16)13(12(17)5-8)9-2-1-7(6-18)3-10(9)15/h1-5H,6,18H2 |
| InChIKey | LZJUOIZVWRAMJH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine?
The IUPAC name of [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine (CID 104729116) is [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine.
What is the SMILES notation for [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine?
The canonical SMILES for [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine is NCc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1.
What is the InChIKey of [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine?
The InChIKey is LZJUOIZVWRAMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl4N/c14-8-4-11(16)13(12(17)5-8)9-2-1-7(6-18)3-10(9)15/h1-5H,6,18H2.
What are the key properties of [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine?
[3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine has a molecular weight of 321.03 g/mol, XLogP of 5.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4-(2,4,6-trichlorophenyl)phenyl]methanamine is sourced from PubChem (CID 104729116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).