C14H20N4O2 — CID 104729549
4-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanoic acid (PubChem CID 104729549) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanoic acid.
| Compound Name | 4-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 104729549 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-[(2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-yl)amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)Nc1nccn2nc(C(C)C)cc12 |
| InChI | InChI=1S/C14H20N4O2/c1-9(2)11-8-12-14(15-6-7-18(12)17-11)16-10(3)4-5-13(19)20/h6-10H,4-5H2,1-3H3,(H,15,16)(H,19,20) |
| InChIKey | KNDSQRQKJOPXKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |