C22H36O3 — CID 10472966
(2S,3R,4S,6R)-6-[(2E,4E,8E)-6,8-dimethyltrideca-2,4,8,12-tetraenyl]-2,3-dimethyloxane-2,4-diol (PubChem CID 10472966) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2S,3R,4S,6R)-6-[(2E,4E,8E)-6,8-dimethyltrideca-2,4,8,12-tetraenyl]-2,3-dimethyloxane-2,4-diol.
| Compound Name | (2S,3R,4S,6R)-6-[(2E,4E,8E)-6,8-dimethyltrideca-2,4,8,12-tetraenyl]-2,3-dimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 10472966 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (2S,3R,4S,6R)-6-[(2E,4E,8E)-6,8-dimethyltrideca-2,4,8,12-tetraenyl]-2,3-dimethyloxane-2,4-diol |
| SMILES | C=CCC/C=C(\C)CC(C)/C=C/C=C/C[C@@H]1C[C@H](O)[C@@H](C)[C@@](C)(O)O1 |
| InChI | InChI=1S/C22H36O3/c1-6-7-9-12-17(2)15-18(3)13-10-8-11-14-20-16-21(23)19(4)22(5,24)25-20/h6,8,10-13,18-21,23-24H,1,7,9,14-16H2,2-5H3/b11-8+,13-10+,17-12+/t18?,19-,20-,21+,22+/m1/s1 |
| InChIKey | XQXASYPXMXVQCZ-DSDKXCLFSA-N |
| XLogP | 4.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|